C18H16BrClFNO2S — CID 146252183
[2-bromo-4-[[cyclopropyl(methyl)amino]sulfanyloxymethyl]phenyl]-(2-chloro-4-fluorophenyl)methanone (PubChem CID 146252183) has the molecular formula C18H16BrClFNO2S and a molecular weight of 444.75 g/mol. Its IUPAC name is [2-bromo-4-[[cyclopropyl(methyl)amino]sulfanyloxymethyl]phenyl]-(2-chloro-4-fluorophenyl)methanone.
| Compound Name | [2-bromo-4-[[cyclopropyl(methyl)amino]sulfanyloxymethyl]phenyl]-(2-chloro-4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 146252183 |
| Molecular Formula | C18H16BrClFNO2S |
| Molecular Weight | 444.75 g/mol |
| Exact Mass | 442.98 |
| IUPAC Name | [2-bromo-4-[[cyclopropyl(methyl)amino]sulfanyloxymethyl]phenyl]-(2-chloro-4-fluorophenyl)methanone |
| SMILES | CN(SOCc1ccc(C(=O)c2ccc(F)cc2Cl)c(Br)c1)C1CC1 |
| InChI | InChI=1S/C18H16BrClFNO2S/c1-22(13-4-5-13)25-24-10-11-2-6-14(16(19)8-11)18(23)15-7-3-12(21)9-17(15)20/h2-3,6-9,13H,4-5,10H2,1H3 |
| InChIKey | UVLPFZXLHISXRU-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.75 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|