C16H36N2 — CID 146252280
N-butyl-N'-(2,4-dimethylheptyl)propane-1,3-diamine (PubChem CID 146252280) has the molecular formula C16H36N2 and a molecular weight of 256.48 g/mol. Its IUPAC name is N-butyl-N'-(2,4-dimethylheptyl)propane-1,3-diamine.
| Compound Name | N-butyl-N'-(2,4-dimethylheptyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 146252280 |
| Molecular Formula | C16H36N2 |
| Molecular Weight | 256.48 g/mol |
| Exact Mass | 256.29 |
| IUPAC Name | N-butyl-N'-(2,4-dimethylheptyl)propane-1,3-diamine |
| SMILES | CCCCNCCCNCC(C)CC(C)CCC |
| InChI | InChI=1S/C16H36N2/c1-5-7-10-17-11-8-12-18-14-16(4)13-15(3)9-6-2/h15-18H,5-14H2,1-4H3 |
| InChIKey | HLJKIVUPJXBAAI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|