About 2-[4-[(3,5-dimethylpiperazin-1-yl)methyl]phenyl]-5-pyrrolidin-1-ylpyrazine
2-[4-[(3,5-dimethylpiperazin-1-yl)methyl]phenyl]-5-pyrrolidin-1-ylpyrazine (PubChem CID 146252770) has the molecular formula C21H29N5
and a molecular weight of 351.50 g/mol. Its IUPAC name is 2-[4-[(3,5-dimethylpiperazin-1-yl)methyl]phenyl]-5-pyrrolidin-1-ylpyrazine.
Molecular Properties
| Compound Name | 2-[4-[(3,5-dimethylpiperazin-1-yl)methyl]phenyl]-5-pyrrolidin-1-ylpyrazine |
| PubChem CID | 146252770 |
| Molecular Formula | C21H29N5 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | 2-[4-[(3,5-dimethylpiperazin-1-yl)methyl]phenyl]-5-pyrrolidin-1-ylpyrazine |
| SMILES | CC1CN(Cc2ccc(-c3cnc(N4CCCC4)cn3)cc2)CC(C)N1 |
| InChI | InChI=1S/C21H29N5/c1-16-13-25(14-17(2)24-16)15-18-5-7-19(8-6-18)20-11-23-21(12-22-20)26-9-3-4-10-26/h5-8,11-12,16-17,24H,3-4,9-10,13-15H2,1-2H3 |
| InChIKey | BWTVZRBGULUXPF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[(3,5-dimethylpiperazin-1-yl)methyl]phenyl]-5-pyrrolidin-1-ylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(3,5-dimethylpiperazin-1-yl)methyl]phenyl]-5-pyrrolidin-1-ylpyrazine?
The IUPAC name of 2-[4-[(3,5-dimethylpiperazin-1-yl)methyl]phenyl]-5-pyrrolidin-1-ylpyrazine (CID 146252770) is 2-[4-[(3,5-dimethylpiperazin-1-yl)methyl]phenyl]-5-pyrrolidin-1-ylpyrazine.
What is the SMILES notation for 2-[4-[(3,5-dimethylpiperazin-1-yl)methyl]phenyl]-5-pyrrolidin-1-ylpyrazine?
The canonical SMILES for 2-[4-[(3,5-dimethylpiperazin-1-yl)methyl]phenyl]-5-pyrrolidin-1-ylpyrazine is CC1CN(Cc2ccc(-c3cnc(N4CCCC4)cn3)cc2)CC(C)N1.
What is the InChIKey of 2-[4-[(3,5-dimethylpiperazin-1-yl)methyl]phenyl]-5-pyrrolidin-1-ylpyrazine?
The InChIKey is BWTVZRBGULUXPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29N5/c1-16-13-25(14-17(2)24-16)15-18-5-7-19(8-6-18)20-11-23-21(12-22-20)26-9-3-4-10-26/h5-8,11-12,16-17,24H,3-4,9-10,13-15H2,1-2H3.
What are the key properties of 2-[4-[(3,5-dimethylpiperazin-1-yl)methyl]phenyl]-5-pyrrolidin-1-ylpyrazine?
2-[4-[(3,5-dimethylpiperazin-1-yl)methyl]phenyl]-5-pyrrolidin-1-ylpyrazine has a molecular weight of 351.50 g/mol, XLogP of 2.93, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(3,5-dimethylpiperazin-1-yl)methyl]phenyl]-5-pyrrolidin-1-ylpyrazine is sourced from PubChem (CID 146252770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).