C20H25N5O — CID 146252780
4-[[4-(5-pyrrolidin-1-ylpyrazin-2-yl)phenyl]methyl]piperazine-1-carbaldehyde (PubChem CID 146252780) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-[[4-(5-pyrrolidin-1-ylpyrazin-2-yl)phenyl]methyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[[4-(5-pyrrolidin-1-ylpyrazin-2-yl)phenyl]methyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 146252780 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 4-[[4-(5-pyrrolidin-1-ylpyrazin-2-yl)phenyl]methyl]piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(Cc2ccc(-c3cnc(N4CCCC4)cn3)cc2)CC1 |
| InChI | InChI=1S/C20H25N5O/c26-16-24-11-9-23(10-12-24)15-17-3-5-18(6-4-17)19-13-22-20(14-21-19)25-7-1-2-8-25/h3-6,13-14,16H,1-2,7-12,15H2 |
| InChIKey | LTXBVPGDGMXAGT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|