C20H27N5 — CID 146252670
2-[4-[[(3R)-3-methylpiperazin-1-yl]methyl]phenyl]-5-pyrrolidin-1-ylpyrimidine (PubChem CID 146252670) has the molecular formula C20H27N5 and a molecular weight of 337.47 g/mol. Its IUPAC name is 2-[4-[[(3R)-3-methylpiperazin-1-yl]methyl]phenyl]-5-pyrrolidin-1-ylpyrimidine.
| Compound Name | 2-[4-[[(3R)-3-methylpiperazin-1-yl]methyl]phenyl]-5-pyrrolidin-1-ylpyrimidine |
|---|---|
| PubChem CID | 146252670 |
| Molecular Formula | C20H27N5 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 2-[4-[[(3R)-3-methylpiperazin-1-yl]methyl]phenyl]-5-pyrrolidin-1-ylpyrimidine |
| SMILES | C[C@@H]1CN(Cc2ccc(-c3ncc(N4CCCC4)cn3)cc2)CCN1 |
| InChI | InChI=1S/C20H27N5/c1-16-14-24(11-8-21-16)15-17-4-6-18(7-5-17)20-22-12-19(13-23-20)25-9-2-3-10-25/h4-7,12-13,16,21H,2-3,8-11,14-15H2,1H3/t16-/m1/s1 |
| InChIKey | PCMLIAONACNOSQ-MRXNPFEDSA-N |
| XLogP | 2.54 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |