C19H15FN4 — CID 146253171
6-fluoro-N-methyl-5-[4-(1H-pyrrolo[2,3-c]pyridin-2-yl)phenyl]pyridin-2-amine (PubChem CID 146253171) has the molecular formula C19H15FN4 and a molecular weight of 318.36 g/mol. Its IUPAC name is 6-fluoro-N-methyl-5-[4-(1H-pyrrolo[2,3-c]pyridin-2-yl)phenyl]pyridin-2-amine.
| Compound Name | 6-fluoro-N-methyl-5-[4-(1H-pyrrolo[2,3-c]pyridin-2-yl)phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 146253171 |
| Molecular Formula | C19H15FN4 |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 6-fluoro-N-methyl-5-[4-(1H-pyrrolo[2,3-c]pyridin-2-yl)phenyl]pyridin-2-amine |
| SMILES | CNc1ccc(-c2ccc(-c3cc4ccncc4[nH]3)cc2)c(F)n1 |
| InChI | InChI=1S/C19H15FN4/c1-21-18-7-6-15(19(20)24-18)12-2-4-13(5-3-12)16-10-14-8-9-22-11-17(14)23-16/h2-11,23H,1H3,(H,21,24) |
| InChIKey | LTVRNEYOYQTBNX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|