C16H21Cl2FN4O2 — CID 146253258
tert-butyl (3S)-4-(2,6-dichloro-5-fluoropyridine-3-carboximidoyl)-3-methylpiperazine-1-carboxylate (PubChem CID 146253258) has the molecular formula C16H21Cl2FN4O2 and a molecular weight of 391.27 g/mol. Its IUPAC name is tert-butyl (3S)-4-(2,6-dichloro-5-fluoropyridine-3-carboximidoyl)-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-(2,6-dichloro-5-fluoropyridine-3-carboximidoyl)-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 146253258 |
| Molecular Formula | C16H21Cl2FN4O2 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | tert-butyl (3S)-4-(2,6-dichloro-5-fluoropyridine-3-carboximidoyl)-3-methylpiperazine-1-carboxylate |
| SMILES | [H]/N=C(/c1cc(F)c(Cl)nc1Cl)N1CCN(C(=O)OC(C)(C)C)C[C@@H]1C |
| InChI | InChI=1S/C16H21Cl2FN4O2/c1-9-8-22(15(24)25-16(2,3)4)5-6-23(9)14(20)10-7-11(19)13(18)21-12(10)17/h7,9,20H,5-6,8H2,1-4H3/b20-14-/t9-/m0/s1 |
| InChIKey | MXVCMCBHSRDRFH-ULUVTIDASA-N |
| XLogP | 3.79 |
| TPSA | 69.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|