C17H36O2P+ — CID 146254097
(3,5-dimethyl-5-pentan-3-yloxyheptan-3-yl)-oxo-propan-2-ylphosphanium (PubChem CID 146254097) has the molecular formula C17H36O2P+ and a molecular weight of 303.45 g/mol. Its IUPAC name is (3,5-dimethyl-5-pentan-3-yloxyheptan-3-yl)-oxo-propan-2-ylphosphanium.
| Compound Name | (3,5-dimethyl-5-pentan-3-yloxyheptan-3-yl)-oxo-propan-2-ylphosphanium |
|---|---|
| PubChem CID | 146254097 |
| Molecular Formula | C17H36O2P+ |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | (3,5-dimethyl-5-pentan-3-yloxyheptan-3-yl)-oxo-propan-2-ylphosphanium |
| SMILES | CCC(CC)OC(C)(CC)CC(C)(CC)[P+](=O)C(C)C |
| InChI | InChI=1S/C17H36O2P/c1-9-15(10-2)19-16(7,11-3)13-17(8,12-4)20(18)14(5)6/h14-15H,9-13H2,1-8H3/q+1 |
| InChIKey | GIOSTAMMKOYPCH-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|