C20H43NO3 — CID 91276899
4-[2-(diethylamino)ethoxy]-4-ethyl-2-methyl-2-pentan-3-yloxyhexan-1-ol (PubChem CID 91276899) has the molecular formula C20H43NO3 and a molecular weight of 345.57 g/mol. Its IUPAC name is 4-[2-(diethylamino)ethoxy]-4-ethyl-2-methyl-2-pentan-3-yloxyhexan-1-ol.
| Compound Name | 4-[2-(diethylamino)ethoxy]-4-ethyl-2-methyl-2-pentan-3-yloxyhexan-1-ol |
|---|---|
| PubChem CID | 91276899 |
| Molecular Formula | C20H43NO3 |
| Molecular Weight | 345.57 g/mol |
| Exact Mass | 345.32 |
| IUPAC Name | 4-[2-(diethylamino)ethoxy]-4-ethyl-2-methyl-2-pentan-3-yloxyhexan-1-ol |
| SMILES | CCC(CC)OC(C)(CO)CC(CC)(CC)OCCN(CC)CC |
| InChI | InChI=1S/C20H43NO3/c1-8-18(9-2)24-19(7,17-22)16-20(10-3,11-4)23-15-14-21(12-5)13-6/h18,22H,8-17H2,1-7H3 |
| InChIKey | UZSIWPCOLGHEDT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |