C31H29F2N5O3 — CID 146254721
3-tert-butyl-13,16-difluoro-19-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-8-oxa-1,20,23-triazapentacyclo[13.6.2.02,7.09,14.018,22]tricosa-2,4,6,9(14),10,12,15,17,19,22-decaen-21-one (PubChem CID 146254721) has the molecular formula C31H29F2N5O3 and a molecular weight of 557.60 g/mol. Its IUPAC name is 3-tert-butyl-13,16-difluoro-19-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-8-oxa-1,20,23-triazapentacyclo[13.6.2.02,7.09,14.018,22]tricosa-2,4,6,9(14),10,12,15,17,19,22-decaen-21-one.
| Compound Name | 3-tert-butyl-13,16-difluoro-19-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-8-oxa-1,20,23-triazapentacyclo[13.6.2.02,7.09,14.018,22]tricosa-2,4,6,9(14),10,12,15,17,19,22-decaen-21-one |
|---|---|
| PubChem CID | 146254721 |
| Molecular Formula | C31H29F2N5O3 |
| Molecular Weight | 557.60 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | 3-tert-butyl-13,16-difluoro-19-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-8-oxa-1,20,23-triazapentacyclo[13.6.2.02,7.09,14.018,22]tricosa-2,4,6,9(14),10,12,15,17,19,22-decaen-21-one |
| SMILES | C=CC(=O)N1CCN(c2nc(=O)n3c4nc(c(F)cc24)c2c(F)cccc2oc2cccc(C(C)(C)C)c23)[C@@H](C)C1 |
| InChI | InChI=1S/C31H29F2N5O3/c1-6-24(39)36-13-14-37(17(2)16-36)28-18-15-21(33)26-25-20(32)10-8-11-22(25)41-23-12-7-9-19(31(3,4)5)27(23)38(29(18)34-26)30(40)35-28/h6-12,15,17H,1,13-14,16H2,2-5H3/t17-/m0/s1 |
| InChIKey | XBELMWYVNFDZKA-KRWDZBQOSA-N |
| XLogP | 5.50 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.60 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|