C26H26FNO4 — CID 146260155
methyl 4-[[[4-[(4-fluorophenyl)-propoxymethyl]benzoyl]amino]methyl]benzoate (PubChem CID 146260155) has the molecular formula C26H26FNO4 and a molecular weight of 435.50 g/mol. Its IUPAC name is methyl 4-[[[4-[(4-fluorophenyl)-propoxymethyl]benzoyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[4-[(4-fluorophenyl)-propoxymethyl]benzoyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 146260155 |
| Molecular Formula | C26H26FNO4 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | methyl 4-[[[4-[(4-fluorophenyl)-propoxymethyl]benzoyl]amino]methyl]benzoate |
| SMILES | CCCOC(c1ccc(F)cc1)c1ccc(C(=O)NCc2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C26H26FNO4/c1-3-16-32-24(20-12-14-23(27)15-13-20)19-8-10-21(11-9-19)25(29)28-17-18-4-6-22(7-5-18)26(30)31-2/h4-15,24H,3,16-17H2,1-2H3,(H,28,29) |
| InChIKey | PXVPEVCTHDFAFN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |