C30H50O — CID 146265294
(1R,2R,5R,8S,9R,10R,13S,14S,20S)-1,2,5,14,19,19-hexamethyl-8-propan-2-yl-16-oxahexacyclo[11.9.0.02,10.05,9.014,20.015,17]docosane (PubChem CID 146265294) has the molecular formula C30H50O and a molecular weight of 426.73 g/mol. Its IUPAC name is (1R,2R,5R,8S,9R,10R,13S,14S,20S)-1,2,5,14,19,19-hexamethyl-8-propan-2-yl-16-oxahexacyclo[11.9.0.02,10.05,9.014,20.015,17]docosane.
| Compound Name | (1R,2R,5R,8S,9R,10R,13S,14S,20S)-1,2,5,14,19,19-hexamethyl-8-propan-2-yl-16-oxahexacyclo[11.9.0.02,10.05,9.014,20.015,17]docosane |
|---|---|
| PubChem CID | 146265294 |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | (1R,2R,5R,8S,9R,10R,13S,14S,20S)-1,2,5,14,19,19-hexamethyl-8-propan-2-yl-16-oxahexacyclo[11.9.0.02,10.05,9.014,20.015,17]docosane |
| SMILES | CC(C)[C@@H]1CC[C@]2(C)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)C6OC6CC(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
| InChI | InChI=1S/C30H50O/c1-18(2)19-11-13-27(5)15-16-28(6)20(24(19)27)9-10-23-29(28,7)14-12-22-26(3,4)17-21-25(31-21)30(22,23)8/h18-25H,9-17H2,1-8H3/t19-,20+,21?,22-,23-,24+,25?,27+,28+,29+,30-/m0/s1 |
| InChIKey | HTINPLWBKDGVAW-NWUAXRNMSA-N |
| XLogP | 8.12 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|