C24H30N4O3 — CID 146266006
N-[2-(N,2-dimethylanilino)ethyl]-3-(2,5-dioxo-4-phenylimidazolidin-4-yl)-N-ethylpropanamide (PubChem CID 146266006) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-[2-(N,2-dimethylanilino)ethyl]-3-(2,5-dioxo-4-phenylimidazolidin-4-yl)-N-ethylpropanamide.
| Compound Name | N-[2-(N,2-dimethylanilino)ethyl]-3-(2,5-dioxo-4-phenylimidazolidin-4-yl)-N-ethylpropanamide |
|---|---|
| PubChem CID | 146266006 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | N-[2-(N,2-dimethylanilino)ethyl]-3-(2,5-dioxo-4-phenylimidazolidin-4-yl)-N-ethylpropanamide |
| SMILES | CCN(CCN(C)c1ccccc1C)C(=O)CCC1(c2ccccc2)NC(=O)NC1=O |
| InChI | InChI=1S/C24H30N4O3/c1-4-28(17-16-27(3)20-13-9-8-10-18(20)2)21(29)14-15-24(19-11-6-5-7-12-19)22(30)25-23(31)26-24/h5-13H,4,14-17H2,1-3H3,(H2,25,26,30,31) |
| InChIKey | UUNUVUQIOBMOEQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|