C22H33ClN4O3 — CID 146266024
3-(4-tert-butyl-2,5-dioxoimidazolidin-4-yl)-N-[2-(5-chloro-N,2-dimethylanilino)ethyl]-N-ethylpropanamide (PubChem CID 146266024) has the molecular formula C22H33ClN4O3 and a molecular weight of 436.98 g/mol. Its IUPAC name is 3-(4-tert-butyl-2,5-dioxoimidazolidin-4-yl)-N-[2-(5-chloro-N,2-dimethylanilino)ethyl]-N-ethylpropanamide.
| Compound Name | 3-(4-tert-butyl-2,5-dioxoimidazolidin-4-yl)-N-[2-(5-chloro-N,2-dimethylanilino)ethyl]-N-ethylpropanamide |
|---|---|
| PubChem CID | 146266024 |
| Molecular Formula | C22H33ClN4O3 |
| Molecular Weight | 436.98 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 3-(4-tert-butyl-2,5-dioxoimidazolidin-4-yl)-N-[2-(5-chloro-N,2-dimethylanilino)ethyl]-N-ethylpropanamide |
| SMILES | CCN(CCN(C)c1cc(Cl)ccc1C)C(=O)CCC1(C(C)(C)C)NC(=O)NC1=O |
| InChI | InChI=1S/C22H33ClN4O3/c1-7-27(13-12-26(6)17-14-16(23)9-8-15(17)2)18(28)10-11-22(21(3,4)5)19(29)24-20(30)25-22/h8-9,14H,7,10-13H2,1-6H3,(H2,24,25,29,30) |
| InChIKey | ZRQWACQQTVIMJU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.98 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|