C23H21N5O — CID 146268197
(NE)-N-[3-(1-aminoethyl)-8-[2-(1-methylpyrazol-4-yl)ethynyl]-2-phenylisoquinolin-1-ylidene]hydroxylamine (PubChem CID 146268197) has the molecular formula C23H21N5O and a molecular weight of 383.46 g/mol. Its IUPAC name is (NE)-N-[3-(1-aminoethyl)-8-[2-(1-methylpyrazol-4-yl)ethynyl]-2-phenylisoquinolin-1-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[3-(1-aminoethyl)-8-[2-(1-methylpyrazol-4-yl)ethynyl]-2-phenylisoquinolin-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 146268197 |
| Molecular Formula | C23H21N5O |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (NE)-N-[3-(1-aminoethyl)-8-[2-(1-methylpyrazol-4-yl)ethynyl]-2-phenylisoquinolin-1-ylidene]hydroxylamine |
| SMILES | CC(N)c1cc2cccc(C#Cc3cnn(C)c3)c2/c(=N\O)n1-c1ccccc1 |
| InChI | InChI=1S/C23H21N5O/c1-16(24)21-13-19-8-6-7-18(12-11-17-14-25-27(2)15-17)22(19)23(26-29)28(21)20-9-4-3-5-10-20/h3-10,13-16,29H,24H2,1-2H3/b26-23+ |
| InChIKey | XPGUZEFOBPWHCN-WNAAXNPUSA-N |
| XLogP | 3.07 |
| TPSA | 81.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|