C19H24N2O3 — CID 146271141
N-[4-[[(4-tert-butylphenyl)-hydroxymethyl]amino]-3-hydroxyphenyl]acetamide (PubChem CID 146271141) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is N-[4-[[(4-tert-butylphenyl)-hydroxymethyl]amino]-3-hydroxyphenyl]acetamide.
| Compound Name | N-[4-[[(4-tert-butylphenyl)-hydroxymethyl]amino]-3-hydroxyphenyl]acetamide |
|---|---|
| PubChem CID | 146271141 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-[4-[[(4-tert-butylphenyl)-hydroxymethyl]amino]-3-hydroxyphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(O)c2ccc(C(C)(C)C)cc2)c(O)c1 |
| InChI | InChI=1S/C19H24N2O3/c1-12(22)20-15-9-10-16(17(23)11-15)21-18(24)13-5-7-14(8-6-13)19(2,3)4/h5-11,18,21,23-24H,1-4H3,(H,20,22) |
| InChIKey | DSTPTCHTIJIVRK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|