C17H19BrFN5 — CID 146271473
4-[(3R)-8-bromo-3,4-dimethyl-6-methylidene-1,4-diazocan-1-yl]-3-fluoropyrazolo[1,5-a]pyridine-7-carbonitrile (PubChem CID 146271473) has the molecular formula C17H19BrFN5 and a molecular weight of 392.28 g/mol. Its IUPAC name is 4-[(3R)-8-bromo-3,4-dimethyl-6-methylidene-1,4-diazocan-1-yl]-3-fluoropyrazolo[1,5-a]pyridine-7-carbonitrile.
| Compound Name | 4-[(3R)-8-bromo-3,4-dimethyl-6-methylidene-1,4-diazocan-1-yl]-3-fluoropyrazolo[1,5-a]pyridine-7-carbonitrile |
|---|---|
| PubChem CID | 146271473 |
| Molecular Formula | C17H19BrFN5 |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 4-[(3R)-8-bromo-3,4-dimethyl-6-methylidene-1,4-diazocan-1-yl]-3-fluoropyrazolo[1,5-a]pyridine-7-carbonitrile |
| SMILES | C=C1CC(Br)N(c2ccc(C#N)n3ncc(F)c23)C[C@@H](C)N(C)C1 |
| InChI | InChI=1S/C17H19BrFN5/c1-11-6-16(18)23(10-12(2)22(3)9-11)15-5-4-13(7-20)24-17(15)14(19)8-21-24/h4-5,8,12,16H,1,6,9-10H2,2-3H3/t12-,16?/m1/s1 |
| InChIKey | WAWDKPCCACIQDZ-ZGTOLYCTSA-N |
| XLogP | 3.15 |
| TPSA | 47.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|