C24H29FN8O — CID 171830154
2-[(6R,10S,12R)-4-(7-cyano-3-fluoropyrazolo[1,5-a]pyridin-4-yl)-6,10,12-trimethyl-4,7,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-11-yl]-N,N-dimethylacetamide (PubChem CID 171830154) has the molecular formula C24H29FN8O and a molecular weight of 464.55 g/mol. Its IUPAC name is 2-[(6R,10S,12R)-4-(7-cyano-3-fluoropyrazolo[1,5-a]pyridin-4-yl)-6,10,12-trimethyl-4,7,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-11-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(6R,10S,12R)-4-(7-cyano-3-fluoropyrazolo[1,5-a]pyridin-4-yl)-6,10,12-trimethyl-4,7,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-11-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 171830154 |
| Molecular Formula | C24H29FN8O |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 2-[(6R,10S,12R)-4-(7-cyano-3-fluoropyrazolo[1,5-a]pyridin-4-yl)-6,10,12-trimethyl-4,7,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-11-yl]-N,N-dimethylacetamide |
| SMILES | C[C@@H]1Cc2c(nn3c2CN(c2ccc(C#N)n4ncc(F)c24)C[C@H]3C)[C@H](C)N1CC(=O)N(C)C |
| InChI | InChI=1S/C24H29FN8O/c1-14-8-18-21-12-30(20-7-6-17(9-26)33-24(20)19(25)10-27-33)11-15(2)32(21)28-23(18)16(3)31(14)13-22(34)29(4)5/h6-7,10,14-16H,8,11-13H2,1-5H3/t14-,15-,16+/m1/s1 |
| InChIKey | KDSUDLZNOXFLJB-OAGGEKHMSA-N |
| XLogP | 2.52 |
| TPSA | 85.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|