C25H30FN7O2 — CID 171830199
4-[(6R,12S)-4-(7-cyano-3-fluoropyrazolo[1,5-a]pyridin-4-yl)-6-methyl-4,7,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-12-yl]-2,2,3-trimethylbutanoic acid (PubChem CID 171830199) has the molecular formula C25H30FN7O2 and a molecular weight of 479.56 g/mol. Its IUPAC name is 4-[(6R,12S)-4-(7-cyano-3-fluoropyrazolo[1,5-a]pyridin-4-yl)-6-methyl-4,7,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-12-yl]-2,2,3-trimethylbutanoic acid.
| Compound Name | 4-[(6R,12S)-4-(7-cyano-3-fluoropyrazolo[1,5-a]pyridin-4-yl)-6-methyl-4,7,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-12-yl]-2,2,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 171830199 |
| Molecular Formula | C25H30FN7O2 |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 4-[(6R,12S)-4-(7-cyano-3-fluoropyrazolo[1,5-a]pyridin-4-yl)-6-methyl-4,7,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-12-yl]-2,2,3-trimethylbutanoic acid |
| SMILES | CC(C[C@H]1Cc2c(nn3c2CN(c2ccc(C#N)n4ncc(F)c24)C[C@H]3C)CN1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C25H30FN7O2/c1-14(25(3,4)24(34)35)7-16-8-18-20(11-28-16)30-32-15(2)12-31(13-22(18)32)21-6-5-17(9-27)33-23(21)19(26)10-29-33/h5-6,10,14-16,28H,7-8,11-13H2,1-4H3,(H,34,35)/t14?,15-,16+/m1/s1 |
| InChIKey | SKJHHJGLAYACNV-JAIYHHTPSA-N |
| XLogP | 3.27 |
| TPSA | 111.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|