C23H26FN7O — CID 171830180
4-[(6R,12S)-6,12-dimethyl-11-(oxolan-3-yl)-4,7,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-4-yl]-3-fluoropyrazolo[1,5-a]pyridine-7-carbonitrile (PubChem CID 171830180) has the molecular formula C23H26FN7O and a molecular weight of 435.51 g/mol. Its IUPAC name is 4-[(6R,12S)-6,12-dimethyl-11-(oxolan-3-yl)-4,7,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-4-yl]-3-fluoropyrazolo[1,5-a]pyridine-7-carbonitrile.
| Compound Name | 4-[(6R,12S)-6,12-dimethyl-11-(oxolan-3-yl)-4,7,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-4-yl]-3-fluoropyrazolo[1,5-a]pyridine-7-carbonitrile |
|---|---|
| PubChem CID | 171830180 |
| Molecular Formula | C23H26FN7O |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 4-[(6R,12S)-6,12-dimethyl-11-(oxolan-3-yl)-4,7,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-4-yl]-3-fluoropyrazolo[1,5-a]pyridine-7-carbonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C#N)n3ncc(F)c23)Cc2c3c(nn21)CN(C1CCOC1)[C@@H](C)C3 |
| InChI | InChI=1S/C23H26FN7O/c1-14-7-18-20(11-29(14)17-5-6-32-13-17)27-30-15(2)10-28(12-22(18)30)21-4-3-16(8-25)31-23(21)19(24)9-26-31/h3-4,9,14-15,17H,5-7,10-13H2,1-2H3/t14-,15+,17?/m0/s1 |
| InChIKey | BMNLYSCIIUSNHE-BTPDTDQASA-N |
| XLogP | 2.66 |
| TPSA | 74.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|