C23H30FNOS — CID 146271904
3,3-dibutyl-7-fluoro-5-phenyl-2,4-dihydro-1,5-benzothiazepin-8-ol (PubChem CID 146271904) has the molecular formula C23H30FNOS and a molecular weight of 387.56 g/mol. Its IUPAC name is 3,3-dibutyl-7-fluoro-5-phenyl-2,4-dihydro-1,5-benzothiazepin-8-ol.
| Compound Name | 3,3-dibutyl-7-fluoro-5-phenyl-2,4-dihydro-1,5-benzothiazepin-8-ol |
|---|---|
| PubChem CID | 146271904 |
| Molecular Formula | C23H30FNOS |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 3,3-dibutyl-7-fluoro-5-phenyl-2,4-dihydro-1,5-benzothiazepin-8-ol |
| SMILES | CCCCC1(CCCC)CSc2cc(O)c(F)cc2N(c2ccccc2)C1 |
| InChI | InChI=1S/C23H30FNOS/c1-3-5-12-23(13-6-4-2)16-25(18-10-8-7-9-11-18)20-14-19(24)21(26)15-22(20)27-17-23/h7-11,14-15,26H,3-6,12-13,16-17H2,1-2H3 |
| InChIKey | JXTAHHKHSWOTCJ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |