C24H24F3N3O3 — CID 146273969
N-[1-(4-methylperoxyphenyl)ethyl]-4-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydropyrido[4,3-b][1,4]oxazin-5-amine (PubChem CID 146273969) has the molecular formula C24H24F3N3O3 and a molecular weight of 459.47 g/mol. Its IUPAC name is N-[1-(4-methylperoxyphenyl)ethyl]-4-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydropyrido[4,3-b][1,4]oxazin-5-amine.
| Compound Name | N-[1-(4-methylperoxyphenyl)ethyl]-4-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydropyrido[4,3-b][1,4]oxazin-5-amine |
|---|---|
| PubChem CID | 146273969 |
| Molecular Formula | C24H24F3N3O3 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | N-[1-(4-methylperoxyphenyl)ethyl]-4-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydropyrido[4,3-b][1,4]oxazin-5-amine |
| SMILES | COOc1ccc(C(C)Nc2nccc3c2N(Cc2cccc(C(F)(F)F)c2)CCO3)cc1 |
| InChI | InChI=1S/C24H24F3N3O3/c1-16(18-6-8-20(9-7-18)33-31-2)29-23-22-21(10-11-28-23)32-13-12-30(22)15-17-4-3-5-19(14-17)24(25,26)27/h3-11,14,16H,12-13,15H2,1-2H3,(H,28,29) |
| InChIKey | LXAXCMSFOUWWLY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|