C8H18N2 — CID 14627499
N,N-diethylpyrrolidin-1-amine (PubChem CID 14627499) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is N,N-diethylpyrrolidin-1-amine.
| Compound Name | N,N-diethylpyrrolidin-1-amine |
|---|---|
| PubChem CID | 14627499 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | N,N-diethylpyrrolidin-1-amine |
| SMILES | CCN(CC)N1CCCC1 |
| InChI | InChI=1S/C8H18N2/c1-3-9(4-2)10-7-5-6-8-10/h3-8H2,1-2H3 |
| InChIKey | GAXDYBWKEVPXMS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |