C17H16F3N3O3S — CID 146275779
5-[2-methyl-6-(trifluoromethylsulfanyloxymethyl)morpholin-4-yl]-2-oxo-1H-quinoline-8-carbonitrile (PubChem CID 146275779) has the molecular formula C17H16F3N3O3S and a molecular weight of 399.39 g/mol. Its IUPAC name is 5-[2-methyl-6-(trifluoromethylsulfanyloxymethyl)morpholin-4-yl]-2-oxo-1H-quinoline-8-carbonitrile.
| Compound Name | 5-[2-methyl-6-(trifluoromethylsulfanyloxymethyl)morpholin-4-yl]-2-oxo-1H-quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 146275779 |
| Molecular Formula | C17H16F3N3O3S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 5-[2-methyl-6-(trifluoromethylsulfanyloxymethyl)morpholin-4-yl]-2-oxo-1H-quinoline-8-carbonitrile |
| SMILES | CC1CN(c2ccc(C#N)c3[nH]c(=O)ccc23)CC(COSC(F)(F)F)O1 |
| InChI | InChI=1S/C17H16F3N3O3S/c1-10-7-23(8-12(26-10)9-25-27-17(18,19)20)14-4-2-11(6-21)16-13(14)3-5-15(24)22-16/h2-5,10,12H,7-9H2,1H3,(H,22,24) |
| InChIKey | GMIZCDDNJXKYFW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|