C27H32N6O3 — CID 155708047
6-[2-(8-cyano-2-oxo-1H-quinolin-5-yl)-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-8-yl]-5-methylpyridine-3-carboxylic acid;ethane (PubChem CID 155708047) has the molecular formula C27H32N6O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is 6-[2-(8-cyano-2-oxo-1H-quinolin-5-yl)-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-8-yl]-5-methylpyridine-3-carboxylic acid;ethane.
| Compound Name | 6-[2-(8-cyano-2-oxo-1H-quinolin-5-yl)-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-8-yl]-5-methylpyridine-3-carboxylic acid;ethane |
|---|---|
| PubChem CID | 155708047 |
| Molecular Formula | C27H32N6O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 6-[2-(8-cyano-2-oxo-1H-quinolin-5-yl)-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-8-yl]-5-methylpyridine-3-carboxylic acid;ethane |
| SMILES | CC.Cc1cc(C(=O)O)cnc1N1CCN2C(C)CN(c3ccc(C#N)c4[nH]c(=O)ccc34)CC2C1 |
| InChI | InChI=1S/C25H26N6O3.C2H6/c1-15-9-18(25(33)34)11-27-24(15)29-7-8-31-16(2)12-30(14-19(31)13-29)21-5-3-17(10-26)23-20(21)4-6-22(32)28-23;1-2/h3-6,9,11,16,19H,7-8,12-14H2,1-2H3,(H,28,32)(H,33,34);1-2H3 |
| InChIKey | NBBYKGKGYBAAHW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |