C25H26N6O2 — CID 155708054
6-[(4R,9aR)-2-(8-cyano-2-deuterioquinolin-5-yl)-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-8-yl]-5-methylpyridine-3-carboxylic acid (PubChem CID 155708054) has the molecular formula C25H26N6O2 and a molecular weight of 443.53 g/mol. Its IUPAC name is 6-[(4R,9aR)-2-(8-cyano-2-deuterioquinolin-5-yl)-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-8-yl]-5-methylpyridine-3-carboxylic acid.
| Compound Name | 6-[(4R,9aR)-2-(8-cyano-2-deuterioquinolin-5-yl)-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-8-yl]-5-methylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 155708054 |
| Molecular Formula | C25H26N6O2 |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 6-[(4R,9aR)-2-(8-cyano-2-deuterioquinolin-5-yl)-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-8-yl]-5-methylpyridine-3-carboxylic acid |
| SMILES | [2H]c1ccc2c(N3C[C@@H]4CN(c5ncc(C(=O)O)cc5C)CCN4[C@H](C)C3)ccc(C#N)c2n1 |
| InChI | InChI=1S/C25H26N6O2/c1-16-10-19(25(32)33)12-28-24(16)29-8-9-31-17(2)13-30(15-20(31)14-29)22-6-5-18(11-26)23-21(22)4-3-7-27-23/h3-7,10,12,17,20H,8-9,13-15H2,1-2H3,(H,32,33)/t17-,20+/m1/s1/i7D |
| InChIKey | YJSMPXBZKQDGOV-OGJQRVQCSA-N |
| XLogP | 2.91 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |