C22H28N6 — CID 164578649
5-[(4R,7S,8aS)-4-methyl-7-piperazin-1-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-deuterioquinoline-8-carbonitrile (PubChem CID 164578649) has the molecular formula C22H28N6 and a molecular weight of 377.51 g/mol. Its IUPAC name is 5-[(4R,7S,8aS)-4-methyl-7-piperazin-1-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-deuterioquinoline-8-carbonitrile.
| Compound Name | 5-[(4R,7S,8aS)-4-methyl-7-piperazin-1-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-deuterioquinoline-8-carbonitrile |
|---|---|
| PubChem CID | 164578649 |
| Molecular Formula | C22H28N6 |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | 5-[(4R,7S,8aS)-4-methyl-7-piperazin-1-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-deuterioquinoline-8-carbonitrile |
| SMILES | [2H]c1ccc2c(N3C[C@@H]4C[C@H](N5CCNCC5)CN4[C@H](C)C3)ccc(C#N)c2n1 |
| InChI | InChI=1S/C22H28N6/c1-16-13-27(21-5-4-17(12-23)22-20(21)3-2-6-25-22)14-19-11-18(15-28(16)19)26-9-7-24-8-10-26/h2-6,16,18-19,24H,7-11,13-15H2,1H3/t16-,18+,19+/m1/s1/i6D |
| InChIKey | IPFQGZAHUBGWOL-WBTZECKBSA-N |
| XLogP | 1.66 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |