C18H20BN5 — CID 174090514
CID 174090514 (PubChem CID 174090514) has the molecular formula C18H20BN5 and a molecular weight of 317.21 g/mol.
| Compound Name | CID 174090514 |
|---|---|
| PubChem CID | 174090514 |
| Molecular Formula | C18H20BN5 |
| Molecular Weight | 317.21 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(N3CC(C)N4CCNCC4C3)ccc(C#N)c2n1 |
| InChI | InChI=1S/C18H20BN5/c1-12-10-23(11-14-9-21-6-7-24(12)14)16-4-2-13(8-20)18-15(16)3-5-17(19)22-18/h2-5,12,14,21H,6-7,9-11H2,1H3 |
| InChIKey | OBZHZBJXLWXYJZ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 55.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.21 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|