C27H32N8 — CID 155205768
5-[(4R,9aS)-4-methyl-8-(2-piperazin-1-yl-4-pyridinyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile (PubChem CID 155205768) has the molecular formula C27H32N8 and a molecular weight of 468.61 g/mol. Its IUPAC name is 5-[(4R,9aS)-4-methyl-8-(2-piperazin-1-yl-4-pyridinyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(4R,9aS)-4-methyl-8-(2-piperazin-1-yl-4-pyridinyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 155205768 |
| Molecular Formula | C27H32N8 |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | 5-[(4R,9aS)-4-methyl-8-(2-piperazin-1-yl-4-pyridinyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3ncccc23)C[C@@H]2CN(c3ccnc(N4CCNCC4)c3)CCN21 |
| InChI | InChI=1S/C27H32N8/c1-20-17-34(25-5-4-21(16-28)27-24(25)3-2-7-31-27)19-23-18-33(13-14-35(20)23)22-6-8-30-26(15-22)32-11-9-29-10-12-32/h2-8,15,20,23,29H,9-14,17-19H2,1H3/t20-,23+/m1/s1 |
| InChIKey | CDNXTDLSEHQPQG-OFNKIYASSA-N |
| XLogP | 2.31 |
| TPSA | 74.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |