C28H32N6 — CID 153371975
5-[4-methyl-8-(6-methyl-1,4-diazepan-1-yl)-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile (PubChem CID 153371975) has the molecular formula C28H32N6 and a molecular weight of 452.61 g/mol. Its IUPAC name is 5-[4-methyl-8-(6-methyl-1,4-diazepan-1-yl)-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[4-methyl-8-(6-methyl-1,4-diazepan-1-yl)-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 153371975 |
| Molecular Formula | C28H32N6 |
| Molecular Weight | 452.61 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 5-[4-methyl-8-(6-methyl-1,4-diazepan-1-yl)-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile |
| SMILES | CC1CNCCN(c2ccc3c(c2)CN2C(C)CN(c4ccc(C#N)c5ncccc45)CC32)C1 |
| InChI | InChI=1S/C28H32N6/c1-19-14-30-10-11-32(15-19)23-6-7-24-22(12-23)17-34-20(2)16-33(18-27(24)34)26-8-5-21(13-29)28-25(26)4-3-9-31-28/h3-9,12,19-20,27,30H,10-11,14-18H2,1-2H3 |
| InChIKey | ZIWDBGBVYPTJLR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.61 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|