C27H28N6 — CID 155775638
5-[(4R,10bS)-8-(2,6-diazaspiro[3.3]heptan-2-yl)-4-methyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile (PubChem CID 155775638) has the molecular formula C27H28N6 and a molecular weight of 436.56 g/mol. Its IUPAC name is 5-[(4R,10bS)-8-(2,6-diazaspiro[3.3]heptan-2-yl)-4-methyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(4R,10bS)-8-(2,6-diazaspiro[3.3]heptan-2-yl)-4-methyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 155775638 |
| Molecular Formula | C27H28N6 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 5-[(4R,10bS)-8-(2,6-diazaspiro[3.3]heptan-2-yl)-4-methyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3ncccc23)C[C@@H]2c3ccc(N4CC5(CNC5)C4)cc3CN12 |
| InChI | InChI=1S/C27H28N6/c1-18-11-31(24-7-4-19(10-28)26-23(24)3-2-8-30-26)13-25-22-6-5-21(9-20(22)12-33(18)25)32-16-27(17-32)14-29-15-27/h2-9,18,25,29H,11-17H2,1H3/t18-,25-/m1/s1 |
| InChIKey | DSKHUNJNZPMWPY-IQGLISFBSA-N |
| XLogP | 3.28 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|