C27H30N6O — CID 146271590
5-[(4R,10bS)-8-[(6R)-6-hydroxy-1,4-diazepan-1-yl]-4-methyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile (PubChem CID 146271590) has the molecular formula C27H30N6O and a molecular weight of 454.58 g/mol. Its IUPAC name is 5-[(4R,10bS)-8-[(6R)-6-hydroxy-1,4-diazepan-1-yl]-4-methyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(4R,10bS)-8-[(6R)-6-hydroxy-1,4-diazepan-1-yl]-4-methyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 146271590 |
| Molecular Formula | C27H30N6O |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 5-[(4R,10bS)-8-[(6R)-6-hydroxy-1,4-diazepan-1-yl]-4-methyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3ncccc23)C[C@@H]2c3ccc(N4CCNC[C@@H](O)C4)cc3CN12 |
| InChI | InChI=1S/C27H30N6O/c1-18-14-32(25-7-4-19(12-28)27-24(25)3-2-8-30-27)17-26-23-6-5-21(11-20(23)15-33(18)26)31-10-9-29-13-22(34)16-31/h2-8,11,18,22,26,29,34H,9-10,13-17H2,1H3/t18-,22-,26-/m1/s1 |
| InChIKey | RIJJJVIFAIEUPI-NDKUEENFSA-N |
| XLogP | 2.64 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|