C27H32N6O — CID 162488627
4-[(4R,10bS)-8-[(6S)-6-hydroxy-1,4-diazepan-1-yl]-4-methyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]-3-[(Z)-3-iminoprop-1-enyl]benzonitrile (PubChem CID 162488627) has the molecular formula C27H32N6O and a molecular weight of 456.59 g/mol. Its IUPAC name is 4-[(4R,10bS)-8-[(6S)-6-hydroxy-1,4-diazepan-1-yl]-4-methyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]-3-[(Z)-3-iminoprop-1-enyl]benzonitrile.
| Compound Name | 4-[(4R,10bS)-8-[(6S)-6-hydroxy-1,4-diazepan-1-yl]-4-methyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]-3-[(Z)-3-iminoprop-1-enyl]benzonitrile |
|---|---|
| PubChem CID | 162488627 |
| Molecular Formula | C27H32N6O |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 4-[(4R,10bS)-8-[(6S)-6-hydroxy-1,4-diazepan-1-yl]-4-methyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]-3-[(Z)-3-iminoprop-1-enyl]benzonitrile |
| SMILES | [H]/N=C/C=C\c1cc(C#N)ccc1N1C[C@@H](C)N2Cc3cc(N4CCNC[C@H](O)C4)ccc3[C@H]2C1 |
| InChI | InChI=1S/C27H32N6O/c1-19-15-32(26-7-4-20(13-29)11-21(26)3-2-8-28)18-27-25-6-5-23(12-22(25)16-33(19)27)31-10-9-30-14-24(34)17-31/h2-8,11-12,19,24,27-28,30,34H,9-10,14-18H2,1H3/b3-2-,28-8+/t19-,24+,27-/m1/s1 |
| InChIKey | DPJPXFLGVZLGFY-MYMWIHAASA-N |
| XLogP | 2.76 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|