C26H31N7O — CID 146271551
4-[8-(4-amino-3-methoxypiperidin-1-yl)-4-methyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]pyrazolo[1,5-a]pyridine-7-carbonitrile (PubChem CID 146271551) has the molecular formula C26H31N7O and a molecular weight of 457.58 g/mol. Its IUPAC name is 4-[8-(4-amino-3-methoxypiperidin-1-yl)-4-methyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]pyrazolo[1,5-a]pyridine-7-carbonitrile.
| Compound Name | 4-[8-(4-amino-3-methoxypiperidin-1-yl)-4-methyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]pyrazolo[1,5-a]pyridine-7-carbonitrile |
|---|---|
| PubChem CID | 146271551 |
| Molecular Formula | C26H31N7O |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 4-[8-(4-amino-3-methoxypiperidin-1-yl)-4-methyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]pyrazolo[1,5-a]pyridine-7-carbonitrile |
| SMILES | COC1CN(c2ccc3c(c2)CN2C(C)CN(c4ccc(C#N)n5nccc45)CC32)CCC1N |
| InChI | InChI=1S/C26H31N7O/c1-17-13-31(23-6-4-20(12-27)33-24(23)7-9-29-33)15-25-21-5-3-19(11-18(21)14-32(17)25)30-10-8-22(28)26(16-30)34-2/h3-7,9,11,17,22,25-26H,8,10,13-16,28H2,1-2H3 |
| InChIKey | VFGSOXDITYVSLP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|