C26H30N8 — CID 155708046
5-[(9aS)-8-[2-(3-aminoazetidin-1-yl)-4-pyridinyl]-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile (PubChem CID 155708046) has the molecular formula C26H30N8 and a molecular weight of 454.58 g/mol. Its IUPAC name is 5-[(9aS)-8-[2-(3-aminoazetidin-1-yl)-4-pyridinyl]-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(9aS)-8-[2-(3-aminoazetidin-1-yl)-4-pyridinyl]-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 155708046 |
| Molecular Formula | C26H30N8 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | 5-[(9aS)-8-[2-(3-aminoazetidin-1-yl)-4-pyridinyl]-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile |
| SMILES | CC1CN(c2ccc(C#N)c3ncccc23)C[C@@H]2CN(c3ccnc(N4CC(N)C4)c3)CCN12 |
| InChI | InChI=1S/C26H30N8/c1-18-13-32(24-5-4-19(12-27)26-23(24)3-2-7-30-26)17-22-16-31(9-10-34(18)22)21-6-8-29-25(11-21)33-14-20(28)15-33/h2-8,11,18,20,22H,9-10,13-17,28H2,1H3/t18?,22-/m0/s1 |
| InChIKey | IGBOMXOQNRJRDQ-YSYXNDDBSA-N |
| XLogP | 2.05 |
| TPSA | 88.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |