C29H36N8 — CID 155205964
5-[8-[2-[5-(3-aminopyrrolidin-1-yl)-2-pyridinyl]ethyl]-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile (PubChem CID 155205964) has the molecular formula C29H36N8 and a molecular weight of 496.66 g/mol. Its IUPAC name is 5-[8-[2-[5-(3-aminopyrrolidin-1-yl)-2-pyridinyl]ethyl]-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[8-[2-[5-(3-aminopyrrolidin-1-yl)-2-pyridinyl]ethyl]-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 155205964 |
| Molecular Formula | C29H36N8 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.31 |
| IUPAC Name | 5-[8-[2-[5-(3-aminopyrrolidin-1-yl)-2-pyridinyl]ethyl]-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile |
| SMILES | CC1CN(c2ccc(C#N)c3ncccc23)CC2CN(CCc3ccc(N4CCC(N)C4)cn3)CCN12 |
| InChI | InChI=1S/C29H36N8/c1-21-17-36(28-7-4-22(15-30)29-27(28)3-2-10-32-29)20-26-19-34(13-14-37(21)26)11-9-24-5-6-25(16-33-24)35-12-8-23(31)18-35/h2-7,10,16,21,23,26H,8-9,11-14,17-20,31H2,1H3 |
| InChIKey | TXVYIVFWHNQXOO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 88.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |