C27H30N6 — CID 155206158
5-[(4R,9aS)-8-(2,3-dihydro-1H-isoindol-4-ylmethyl)-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile (PubChem CID 155206158) has the molecular formula C27H30N6 and a molecular weight of 438.58 g/mol. Its IUPAC name is 5-[(4R,9aS)-8-(2,3-dihydro-1H-isoindol-4-ylmethyl)-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(4R,9aS)-8-(2,3-dihydro-1H-isoindol-4-ylmethyl)-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 155206158 |
| Molecular Formula | C27H30N6 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 5-[(4R,9aS)-8-(2,3-dihydro-1H-isoindol-4-ylmethyl)-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3ncccc23)C[C@@H]2CN(Cc3cccc4c3CNC4)CCN21 |
| InChI | InChI=1S/C27H30N6/c1-19-15-32(26-8-7-20(12-28)27-24(26)6-3-9-30-27)18-23-17-31(10-11-33(19)23)16-22-5-2-4-21-13-29-14-25(21)22/h2-9,19,23,29H,10-11,13-18H2,1H3/t19-,23+/m1/s1 |
| InChIKey | KQVCREHOKPBIML-XXBNENTESA-N |
| XLogP | 3.10 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |