C25H27ClN6 — CID 166009313
5-[(4R,9aS)-8-[(6-chloro-2-methyl-3-pyridinyl)methyl]-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile (PubChem CID 166009313) has the molecular formula C25H27ClN6 and a molecular weight of 446.99 g/mol. Its IUPAC name is 5-[(4R,9aS)-8-[(6-chloro-2-methyl-3-pyridinyl)methyl]-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(4R,9aS)-8-[(6-chloro-2-methyl-3-pyridinyl)methyl]-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 166009313 |
| Molecular Formula | C25H27ClN6 |
| Molecular Weight | 446.99 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 5-[(4R,9aS)-8-[(6-chloro-2-methyl-3-pyridinyl)methyl]-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile |
| SMILES | Cc1nc(Cl)ccc1CN1CCN2[C@@H](C1)CN(c1ccc(C#N)c3ncccc13)C[C@H]2C |
| InChI | InChI=1S/C25H27ClN6/c1-17-13-31(23-7-5-19(12-27)25-22(23)4-3-9-28-25)16-21-15-30(10-11-32(17)21)14-20-6-8-24(26)29-18(20)2/h3-9,17,21H,10-11,13-16H2,1-2H3/t17-,21+/m1/s1 |
| InChIKey | UQKPYABDGLMEPR-UTKZUKDTSA-N |
| XLogP | 3.86 |
| TPSA | 59.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.99 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|