C30H37N7 — CID 155191958
5-[(4R,9aS)-4-methyl-8-[2-(4-piperazin-1-ylphenyl)ethyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile (PubChem CID 155191958) has the molecular formula C30H37N7 and a molecular weight of 495.68 g/mol. Its IUPAC name is 5-[(4R,9aS)-4-methyl-8-[2-(4-piperazin-1-ylphenyl)ethyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(4R,9aS)-4-methyl-8-[2-(4-piperazin-1-ylphenyl)ethyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 155191958 |
| Molecular Formula | C30H37N7 |
| Molecular Weight | 495.68 g/mol |
| Exact Mass | 495.31 |
| IUPAC Name | 5-[(4R,9aS)-4-methyl-8-[2-(4-piperazin-1-ylphenyl)ethyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3ncccc23)C[C@@H]2CN(CCc3ccc(N4CCNCC4)cc3)CCN21 |
| InChI | InChI=1S/C30H37N7/c1-23-20-36(29-9-6-25(19-31)30-28(29)3-2-11-33-30)22-27-21-34(17-18-37(23)27)14-10-24-4-7-26(8-5-24)35-15-12-32-13-16-35/h2-9,11,23,27,32H,10,12-18,20-22H2,1H3/t23-,27+/m1/s1 |
| InChIKey | JKMFEHFRIPQCGF-KCWPFWIISA-N |
| XLogP | 2.95 |
| TPSA | 61.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.68 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|