C27H32N6 — CID 146320244
5-[3,5-dimethyl-4-[(4-piperazin-1-ylphenyl)methyl]piperazin-1-yl]quinoline-8-carbonitrile (PubChem CID 146320244) has the molecular formula C27H32N6 and a molecular weight of 440.60 g/mol. Its IUPAC name is 5-[3,5-dimethyl-4-[(4-piperazin-1-ylphenyl)methyl]piperazin-1-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[3,5-dimethyl-4-[(4-piperazin-1-ylphenyl)methyl]piperazin-1-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 146320244 |
| Molecular Formula | C27H32N6 |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | 5-[3,5-dimethyl-4-[(4-piperazin-1-ylphenyl)methyl]piperazin-1-yl]quinoline-8-carbonitrile |
| SMILES | CC1CN(c2ccc(C#N)c3ncccc23)CC(C)N1Cc1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C27H32N6/c1-20-17-32(26-10-7-23(16-28)27-25(26)4-3-11-30-27)18-21(2)33(20)19-22-5-8-24(9-6-22)31-14-12-29-13-15-31/h3-11,20-21,29H,12-15,17-19H2,1-2H3 |
| InChIKey | NOVDNBNQZKLLBB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.60 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|