C25H33N7 — CID 146320258
5-[(3S,5R)-3,5-dimethyl-4-[(5-piperazin-1-yl-2-pyridinyl)methyl]piperazin-1-yl]quinolin-8-amine (PubChem CID 146320258) has the molecular formula C25H33N7 and a molecular weight of 431.59 g/mol. Its IUPAC name is 5-[(3S,5R)-3,5-dimethyl-4-[(5-piperazin-1-yl-2-pyridinyl)methyl]piperazin-1-yl]quinolin-8-amine.
| Compound Name | 5-[(3S,5R)-3,5-dimethyl-4-[(5-piperazin-1-yl-2-pyridinyl)methyl]piperazin-1-yl]quinolin-8-amine |
|---|---|
| PubChem CID | 146320258 |
| Molecular Formula | C25H33N7 |
| Molecular Weight | 431.59 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | 5-[(3S,5R)-3,5-dimethyl-4-[(5-piperazin-1-yl-2-pyridinyl)methyl]piperazin-1-yl]quinolin-8-amine |
| SMILES | C[C@@H]1CN(c2ccc(N)c3ncccc23)C[C@H](C)N1Cc1ccc(N2CCNCC2)cn1 |
| InChI | InChI=1S/C25H33N7/c1-18-15-31(24-8-7-23(26)25-22(24)4-3-9-28-25)16-19(2)32(18)17-20-5-6-21(14-29-20)30-12-10-27-11-13-30/h3-9,14,18-19,27H,10-13,15-17,26H2,1-2H3/t18-,19+ |
| InChIKey | OUUUABIPIBFESA-KDURUIRLSA-N |
| XLogP | 2.72 |
| TPSA | 73.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.59 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|