C21H18ClN5 — CID 175692806
5-[6-[(6-chloro-3-pyridinyl)methyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]quinoline-8-carbonitrile (PubChem CID 175692806) has the molecular formula C21H18ClN5 and a molecular weight of 375.86 g/mol. Its IUPAC name is 5-[6-[(6-chloro-3-pyridinyl)methyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[6-[(6-chloro-3-pyridinyl)methyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 175692806 |
| Molecular Formula | C21H18ClN5 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 5-[6-[(6-chloro-3-pyridinyl)methyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]quinoline-8-carbonitrile |
| SMILES | N#Cc1ccc(N2CC3CC(C2)N3Cc2ccc(Cl)nc2)c2cccnc12 |
| InChI | InChI=1S/C21H18ClN5/c22-20-6-3-14(10-25-20)11-27-16-8-17(27)13-26(12-16)19-5-4-15(9-23)21-18(19)2-1-7-24-21/h1-7,10,16-17H,8,11-13H2 |
| InChIKey | IXJZVGWKAWJEIB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|