C16H15Cl3FN3 — CID 146280054
1-(3-chloro-4-fluorophenyl)-4-(2,4-dichloro-3-pyridinyl)-1,4-diazepane (PubChem CID 146280054) has the molecular formula C16H15Cl3FN3 and a molecular weight of 374.67 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-4-(2,4-dichloro-3-pyridinyl)-1,4-diazepane.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-4-(2,4-dichloro-3-pyridinyl)-1,4-diazepane |
|---|---|
| PubChem CID | 146280054 |
| Molecular Formula | C16H15Cl3FN3 |
| Molecular Weight | 374.67 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-4-(2,4-dichloro-3-pyridinyl)-1,4-diazepane |
| SMILES | Fc1ccc(N2CCCN(c3c(Cl)ccnc3Cl)CC2)cc1Cl |
| InChI | InChI=1S/C16H15Cl3FN3/c17-12-4-5-21-16(19)15(12)23-7-1-6-22(8-9-23)11-2-3-14(20)13(18)10-11/h2-5,10H,1,6-9H2 |
| InChIKey | AFNGOFXOHPJJKM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.67 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|