C23H26N2O4S2 — CID 14628073
2-[4-(4-acetyl-3-hydroxy-2-propylphenyl)sulfanylbutylsulfanyl]-3H-benzimidazole-5-carboxylic acid (PubChem CID 14628073) has the molecular formula C23H26N2O4S2 and a molecular weight of 458.61 g/mol. Its IUPAC name is 2-[4-(4-acetyl-3-hydroxy-2-propylphenyl)sulfanylbutylsulfanyl]-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 2-[4-(4-acetyl-3-hydroxy-2-propylphenyl)sulfanylbutylsulfanyl]-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 14628073 |
| Molecular Formula | C23H26N2O4S2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 2-[4-(4-acetyl-3-hydroxy-2-propylphenyl)sulfanylbutylsulfanyl]-3H-benzimidazole-5-carboxylic acid |
| SMILES | CCCc1c(SCCCCSc2nc3ccc(C(=O)O)cc3[nH]2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C23H26N2O4S2/c1-3-6-17-20(10-8-16(14(2)26)21(17)27)30-11-4-5-12-31-23-24-18-9-7-15(22(28)29)13-19(18)25-23/h7-10,13,27H,3-6,11-12H2,1-2H3,(H,24,25)(H,28,29) |
| InChIKey | JWVDXRJXXYKABA-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|