C23H28O5S — CID 70500994
3-[4-[3-(4-acetyl-3-hydroxy-2-propylphenyl)sulfanylpropoxy]phenyl]propanoic acid (PubChem CID 70500994) has the molecular formula C23H28O5S and a molecular weight of 416.54 g/mol. Its IUPAC name is 3-[4-[3-(4-acetyl-3-hydroxy-2-propylphenyl)sulfanylpropoxy]phenyl]propanoic acid.
| Compound Name | 3-[4-[3-(4-acetyl-3-hydroxy-2-propylphenyl)sulfanylpropoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 70500994 |
| Molecular Formula | C23H28O5S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 3-[4-[3-(4-acetyl-3-hydroxy-2-propylphenyl)sulfanylpropoxy]phenyl]propanoic acid |
| SMILES | CCCc1c(SCCCOc2ccc(CCC(=O)O)cc2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C23H28O5S/c1-3-5-20-21(12-11-19(16(2)24)23(20)27)29-15-4-14-28-18-9-6-17(7-10-18)8-13-22(25)26/h6-7,9-12,27H,3-5,8,13-15H2,1-2H3,(H,25,26) |
| InChIKey | HLDNINUOEVWDPM-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|