C25H31BrNaO6S — CID 70473396
CID 70473396 (PubChem CID 70473396) has the molecular formula C25H31BrNaO6S and a molecular weight of 562.48 g/mol.
| Compound Name | CID 70473396 |
|---|---|
| PubChem CID | 70473396 |
| Molecular Formula | C25H31BrNaO6S |
| Molecular Weight | 562.48 g/mol |
| Exact Mass | 561.09 |
| IUPAC Name | — |
| SMILES | CCCc1c(OCCCSc2ccc(C(O)C(C)CC(=O)O)cc2Br)ccc(C(C)=O)c1O.[Na] |
| InChI | InChI=1S/C25H31BrO6S.Na/c1-4-6-19-21(9-8-18(16(3)27)25(19)31)32-11-5-12-33-22-10-7-17(14-20(22)26)24(30)15(2)13-23(28)29;/h7-10,14-15,24,30-31H,4-6,11-13H2,1-3H3,(H,28,29); |
| InChIKey | WDBJVMKYWRVWKL-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.48 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|