C16H20N2O3S3 — CID 14723563
1-[2-hydroxy-3-propyl-4-[3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]propoxy]phenyl]ethanone (PubChem CID 14723563) has the molecular formula C16H20N2O3S3 and a molecular weight of 384.55 g/mol. Its IUPAC name is 1-[2-hydroxy-3-propyl-4-[3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]propoxy]phenyl]ethanone.
| Compound Name | 1-[2-hydroxy-3-propyl-4-[3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]propoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 14723563 |
| Molecular Formula | C16H20N2O3S3 |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 1-[2-hydroxy-3-propyl-4-[3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]propoxy]phenyl]ethanone |
| SMILES | CCCc1c(OCCCSc2n[nH]c(=S)s2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C16H20N2O3S3/c1-3-5-12-13(7-6-11(10(2)19)14(12)20)21-8-4-9-23-16-18-17-15(22)24-16/h6-7,20H,3-5,8-9H2,1-2H3,(H,17,22) |
| InChIKey | GHUKTMMYZPCVPW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|