C25H29NaO6S — CID 67944123
sodium 2-[5-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]-1-hydroxy-2,3-dihydro-1H-inden-2-yl]acetate (PubChem CID 67944123) has the molecular formula C25H29NaO6S and a molecular weight of 480.56 g/mol. Its IUPAC name is sodium 2-[5-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]-1-hydroxy-2,3-dihydro-1H-inden-2-yl]acetate.
| Compound Name | sodium 2-[5-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]-1-hydroxy-2,3-dihydro-1H-inden-2-yl]acetate |
|---|---|
| PubChem CID | 67944123 |
| Molecular Formula | C25H29NaO6S |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | sodium 2-[5-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]-1-hydroxy-2,3-dihydro-1H-inden-2-yl]acetate |
| SMILES | CCCc1c(OCCCSc2ccc3c(c2)CC(CC(=O)[O-])C3O)ccc(C(C)=O)c1O.[Na+] |
| InChI | InChI=1S/C25H30O6S.Na/c1-3-5-21-22(9-8-19(15(2)26)25(21)30)31-10-4-11-32-18-6-7-20-16(13-18)12-17(24(20)29)14-23(27)28;/h6-9,13,17,24,29-30H,3-5,10-12,14H2,1-2H3,(H,27,28);/q;+1/p-1 |
| InChIKey | KEQFZUFOKYMVAV-UHFFFAOYSA-M |
| XLogP | 0.46 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|