C26H32FNaO6S — CID 67916628
sodium 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]-3-fluorophenyl]-4-hydroxy-3,3-dimethylbutanoate (PubChem CID 67916628) has the molecular formula C26H32FNaO6S and a molecular weight of 514.59 g/mol. Its IUPAC name is sodium 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]-3-fluorophenyl]-4-hydroxy-3,3-dimethylbutanoate.
| Compound Name | sodium 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]-3-fluorophenyl]-4-hydroxy-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 67916628 |
| Molecular Formula | C26H32FNaO6S |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | sodium 4-[4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]-3-fluorophenyl]-4-hydroxy-3,3-dimethylbutanoate |
| SMILES | CCCc1c(OCCCSc2ccc(C(O)C(C)(C)CC(=O)[O-])cc2F)ccc(C(C)=O)c1O.[Na+] |
| InChI | InChI=1S/C26H33FO6S.Na/c1-5-7-19-21(10-9-18(16(2)28)24(19)31)33-12-6-13-34-22-11-8-17(14-20(22)27)25(32)26(3,4)15-23(29)30;/h8-11,14,25,31-32H,5-7,12-13,15H2,1-4H3,(H,29,30);/q;+1/p-1 |
| InChIKey | ANQHFCFPHDBHDF-UHFFFAOYSA-M |
| XLogP | 1.45 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|