C26H33FO10P2 — CID 57481153
1-[4-[3-[4-[1,2-bis(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)ethyl]-2-fluorophenoxy]propoxy]-2-hydroxy-3-propylphenyl]ethanone (PubChem CID 57481153) has the molecular formula C26H33FO10P2 and a molecular weight of 586.49 g/mol. Its IUPAC name is 1-[4-[3-[4-[1,2-bis(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)ethyl]-2-fluorophenoxy]propoxy]-2-hydroxy-3-propylphenyl]ethanone.
| Compound Name | 1-[4-[3-[4-[1,2-bis(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)ethyl]-2-fluorophenoxy]propoxy]-2-hydroxy-3-propylphenyl]ethanone |
|---|---|
| PubChem CID | 57481153 |
| Molecular Formula | C26H33FO10P2 |
| Molecular Weight | 586.49 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | 1-[4-[3-[4-[1,2-bis(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)ethyl]-2-fluorophenoxy]propoxy]-2-hydroxy-3-propylphenyl]ethanone |
| SMILES | CCCc1c(OCCCOc2ccc(C(CP3(=O)OCCO3)P3(=O)OCCO3)cc2F)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C26H33FO10P2/c1-3-5-21-23(9-7-20(18(2)28)26(21)29)32-10-4-11-33-24-8-6-19(16-22(24)27)25(39(31)36-14-15-37-39)17-38(30)34-12-13-35-38/h6-9,16,25,29H,3-5,10-15,17H2,1-2H3 |
| InChIKey | MXZWXIYAOLHELQ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.49 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|